टेम्पलेट:Infobox mineral

विकिपीडिया से
Jump to navigation Jump to search
जनरल जानकारी

This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.

Usage[संपादन करीं]

Most field names are in lowercase.

Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window.

Ruby cristal.jpg
A naturally occurring ruby crystal
जनरल जानकारी
श्रेणी Mineral variety
(रिपीट होखे वाला इकाई)
aluminium oxide with chromium, Al2O3:Cr
क्रिस्टल सिस्टम Trigonal
क्रिस्टल क्लास Hexagonal scalenohedral (3m)
H-M symbol: (3 2/m)
स्पेस समूह R3c (No. 167)
इकाई सेल unit cell
Color Red, may be brownish, purplish or pinkish
Crystal habit Varies with locality. Terminated tabular hexagonal prisms.
Cleavage No true cleavage
Fracture Uneven or conchoidal
मोहो पैमाना hardness 9.0
Luster Vitreous
Streak white
Diaphaneity transparent
बिसेसक घनत्व 4.0
रिफ्रेक्टिव इंडेक्स nω=1.768 - 1.772 nε=1.760 - 1.763, Birefringence 0.008
Pleochroism Orangey red, purplish red
अल्ट्रावायलेट दमक red under longwave
पघिलाव बिंदु 2044 °C
घुलाव none
प्रमुख किसिम
Sapphire Any color except red and violet
Oriental amethyst violet color
Corundum various colors
(mineral species)
Emery Granular
(mineral mixture)
{{Infobox mineral
| name        = 
| boxwidth    = 
| boxbgcolor  = 
| image       = 
| imagesize   = 
| alt         = 
| caption     = 
| struct image     =
| struct caption   =
| struct imagesize =
| struct2 image    =
| struct2 caption  =
| struct2 imagesize=
| SMILES           =
| Jmol             =
| category    = 
| formula     = 
| molweight   = 
| strunz      = 
| dana        = 
| system      = 
| class       = 
| symmetry    = 
| unit cell   = 
| color       = 
| colour      = 
| habit       = 
| twinning    = 
| cleavage    = 
| fracture    = 
| tenacity    = 
| toughness   = 
| mohs        = 
| luster      = 
| streak      = 
| diaphaneity = 
| gravity     = 
| density     = 
| polish      = 
| opticalprop = 
| refractive  = 
| birefringence = 
| pleochroism = 
| 2V          = 
| dispersion  = 
| extinction  = 
| length fast/slow =
| fluorescence = 
| absorption  = 
| melt        = 
| Curie temp  = 
| fusibility  = 
| diagnostic  = 
| solubility  = 
| impurities  = 
| alteration  = 
| other       = 
| prop1       = 
| prop1text   = 
| references  = 
| var1        = 
| var1text    = 
| var2        = 
| var2text    = 
| var3        = 
| var3text    = 
| var4        = 
| var4text    = 
| var5        = 
| var5text    = 
| var6        = 
| var6text    = 

All parameters used[संपादन करीं]

जनरल जानकारी
श्रेणी category
(रिपीट होखे वाला इकाई)
स्त्रूंज बर्गीकरण strunz
डाना बर्गीकरण dana
क्रिस्टल सिस्टम system
क्रिस्टल क्लास class
स्पेस समूह symmetry
इकाई सेल unit cell


Crystal structure of α-tridymite

Diamond lattice.stl

Some other image
Jmol (3D) Interactive image
Formula mass molweight
Colour colorcolour
Crystal habit habit
Twinning twinning
Cleavage cleavage
Fracture fracture
Tenacity tenacity
मोहो पैमाना hardness mohs
Lustre luster
Streak streak
Diaphaneity diaphaneity
बिसेसक घनत्व gravity
घनत्व density
Polish lustre polish
ऑप्टिकल लच्छन opticalprop
रिफ्रेक्टिव इंडेक्स refractive
Birefringence birefringence
Pleochroism pleochroism
2V कोण 2V
डिस्पर्सन dispersion
Extinction extinction
Length fast/slow length fast/slow
अल्ट्रावायलेट दमक fluorescence
सोखल स्पेक्ट्रम absorption
पघिलाव बिंदु melt
फ्यूजबिलिटी fusibility
भेदाभेद लच्छन diagnostic
घुलाव solubility
आम अशुद्धी सभ impurities
बदले पर alteration
अन्य बिसेसता other
prop1 prop1text
संदर्भ references
प्रमुख किसिम
var1 var1text
var2 var2text
var3 var3text
var4 var4text
var5 var5text
var6 var6text
| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize   = 260px

|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px

|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O<!-- different so will show difgferent struct - to test -->
|boxbgcolor = yellow

| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text

Description[संपादन करीं]

This should describe the parameters used in this template.

Parameter Explanation Example
name IMA mineral name (if there is another common name, put it in parentheses) Baryte (Barite)
boxbgcolor Background color of box headers
boxtextcolor Text color of box headers
image Wikimedia Commons image filename (to go at top) Epidoto.jpeg
alt alt text for image, for visually impaired readers; see WP:ALT Agglomeration of dark cylindrical crystals
caption image caption Epidote crystals
category broad group then subgroup then sub-subgroup (if applicable) template does not auto-link Sulfate minerals, Barite group
formula chemical formula giving the elemental composition of a repeating unit of an alloy, a polymer, a crystal structure, a chain, or a network BaSO4
strunz Nickel-Strunz classification of the mineral (10 ed, MinDat) 9.BG.05
dana Dana classification of the mineral
symmetry Hermann–Mauguin notation of the mineral's symmetry element, labeled: Space group
unit cell Unit cell dimensions and number (Z) of formula units per unit cell
molweight molar mass of the chemical formula above
color common colors of the mineral
colour same as above, but for British pages
habit common mineral habit
system crystal system (cubic, etc.)
class crystal class
twinning common type of twinning
cleavage type of cleavage
fracture type of fracture (appearance of broken surface) irregular
tenacity tenacity (how the mineral can deform or break) brittle
toughness toughness (quantitative resistance to deformation or breakage)
mohs hardness (scratchability) of mineral on Mohs hardness scale 3-3.5
luster way the mineral reflects light, see luster
lustre same as above, but for British pages
streak see streak
diaphaneity transparency of mineral
gravity specific gravity
density density at STP in g/cm3
polish ability to take a polish
refractive refractive index of mineral
birefringence birefringence of a 30micron thin section
pleochroism see pleochroism
2V 2V angle
dispersion see dispersion
extinction extinction angle, e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals).
length fast/slow Sign of elongation: length fast or length slow
fluorescence see fluorescence
absorption see absorption
melt melting point of mineral
Curie Curie temperature of mineral
fusibility fusibility of mineral
diagnostic key way to recognize mineral
solubility solubility of mineral in water at STP
impurities common impurities
alteration alteration products
references use the Wikipedia template:ref to cite References supporting the properties to be added at that line using <ref>...</ref> tag notation. Individual items can be tagged separately if needed.

TemplateData[संपादन करीं]

This is the TemplateData documentation for this template used by VisualEditor and other tools.

TemplateData for Infobox mineral

No description.

Template parameters


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description

unit cellunit cell

no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description

length fast/slowlength fast/slow

no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description

polish lustrepolish lustre

no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description


no description

struct imagestruct image

no description

struct2 imagestruct2 image

no description

struct captionstruct caption

no description

struct imagesizestruct imagesize

no description

struct altstruct alt

no description

struct2 imagesizestruct2 imagesize

no description

struct2 captionstruct2 caption

no description

struct2 altstruct2 alt

no description


no description


no description


Tracking category[संपादन करीं]