Jump to content

टेम्पलेट:Infobox mineral

विकिपीडिया से
{{PAGENAME}}
जनरल जानकारी

This template is used on pages about minerals as well as gemstones to provide handy easy to access data about that mineral.

Usage[संपादन करीं]

Most field names are in lowercase.

Copy a blank version to use. Please delete any unused fields to avoid clutter in the edit window.

Ruby
A naturally occurring ruby crystal
जनरल जानकारी
श्रेणीMineral variety
फार्मूला
(रिपीट होखे वाला इकाई)
aluminium oxide with chromium, Al2O3:Cr
क्रिस्टल सिस्टमTrigonal
क्रिस्टल क्लासHexagonal scalenohedral (3m)
H-M symbol: (3 2/m)
स्पेस समूहR3c (No. 167)
इकाई सेलunit cell
Identification
ColorRed, may be brownish, purplish or pinkish
Crystal habitVaries with locality. Terminated tabular hexagonal prisms.
CleavageNo true cleavage
FractureUneven or conchoidal
मोहो पैमाना hardness9.0
LusterVitreous
Streakwhite
Diaphaneitytransparent
बिसेसक घनत्व4.0
रिफ्रेक्टिव इंडेक्सnω=1.768 - 1.772 nε=1.760 - 1.763, Birefringence 0.008
PleochroismOrangey red, purplish red
अल्ट्रावायलेट दमकred under longwave
पघिलाव बिंदु2044 °C
घुलावnone
प्रमुख किसिम
SapphireAny color except red and violet
Oriental amethystviolet color
Corundumvarious colors
(mineral species)
EmeryGranular
(mineral mixture)
{{Infobox mineral
| name        = 
| boxwidth    = 
| boxbgcolor  = 
| image       = 
| imagesize   = 
| alt         = 
| caption     = 
| struct image     =
| struct caption   =
| struct imagesize =
| struct2 image    =
| struct2 caption  =
| struct2 imagesize=
| SMILES           =
| Jmol             =
| category    = 
| formula     = 
| molweight   = 
| strunz      = 
| dana        = 
| system      = 
| class       = 
| symmetry    = 
| unit cell   = 
| color       = 
| colour      = 
| habit       = 
| twinning    = 
| cleavage    = 
| fracture    = 
| tenacity    = 
| toughness   = 
| mohs        = 
| luster      = 
| streak      = 
| diaphaneity = 
| gravity     = 
| density     = 
| polish      = 
| opticalprop = 
| refractive  = 
| birefringence = 
| pleochroism = 
| 2V          = 
| dispersion  = 
| extinction  = 
| length fast/slow =
| fluorescence = 
| absorption  = 
| melt        = 
| Curie temp  = 
| fusibility  = 
| diagnostic  = 
| solubility  = 
| impurities  = 
| alteration  = 
| other       = 
| prop1       = 
| prop1text   = 
| references  = 
| var1        = 
| var1text    = 
| var2        = 
| var2text    = 
| var3        = 
| var3text    = 
| var4        = 
| var4text    = 
| var5        = 
| var5text    = 
| var6        = 
| var6text    = 
}}

All parameters used[संपादन करीं]

name
alt
caption
जनरल जानकारी
श्रेणीcategory
फार्मूला
(रिपीट होखे वाला इकाई)
formula
स्त्रूंज बर्गीकरणstrunz
डाना बर्गीकरणdana
क्रिस्टल सिस्टमsystem
क्रिस्टल क्लासclass
स्पेस समूहsymmetry
इकाई सेलunit cell
Structure

Crystal structure of α-tridymite

Some other image
Jmol (3D)Interactive image
Identification
Formula massmolweight
Colourcolorcolour
Crystal habithabit
Twinningtwinning
Cleavagecleavage
Fracturefracture
Tenacitytenacity
मोहो पैमाना hardnessmohs
Lustreluster
Streakstreak
Diaphaneitydiaphaneity
बिसेसक घनत्वgravity
घनत्वdensity
Polish lustrepolish
ऑप्टिकल लच्छनopticalprop
रिफ्रेक्टिव इंडेक्सrefractive
Birefringencebirefringence
Pleochroismpleochroism
2V कोण2V
डिस्पर्सनdispersion
Extinctionextinction
Length fast/slowlength fast/slow
अल्ट्रावायलेट दमकfluorescence
सोखल स्पेक्ट्रमabsorption
पघिलाव बिंदुmelt
फ्यूजबिलिटीfusibility
भेदाभेद लच्छनdiagnostic
घुलावsolubility
आम अशुद्धी सभimpurities
बदले परalteration
अन्य बिसेसताother
prop1prop1text
संदर्भreferences
प्रमुख किसिम
var1var1text
var2var2text
var3var3text
var4var4text
var5var5text
var6var6text
| image = Tridymite tabulars - Ochtendung, Eifel, Germany.jpg
| imagesize   = 260px

|struct image=a-tridymite.png
|struct caption=Crystal structure of α-tridymite
|struct imagesize=150px
|struct2 image=Diamond lattice.stl
|struct2 caption=Some other image
|struct2 imagesize=200px

|SMILES = O[C@@H]4C/C3=C/C=C1\[C@H](CC[C@]2([C@H]1CC[C@@H]2[C@H](C)CCCC(C)C)C)[C@@]3(C)CC4
|Jmol= C([C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O<!-- different so will show difgferent struct - to test -->
|boxbgcolor = yellow

| 2V = 2V
| absorption = absorption
| alt = alt
| alteration = alteration
| birefringence = birefringence
| boxtextcolor = boxtextcolor
| boxwidth = boxwidth
| caption = caption
| category = category
| class = class
| cleavage = cleavage
| color = color
| colour = colour
| dana = dana
| density = density
| diagnostic = diagnostic
| diaphaneity = diaphaneity
| dispersion = dispersion
| extinction = extinction
| fluorescence = fluorescence
| formula = formula
| fracture = fracture
| fusibility = fusibility
| gravity = gravity
| habit = habit
| impurities = impurities
| length fast/slow = length fast/slow
| luster = luster
| lustre = lustre
| melt = melt
| mohs = mohs
| molweight = molweight
| name = name
| opticalprop = opticalprop
| other = other
| pleochroism = pleochroism
| polish = polish
| polish lustre = polish lustre
| prop1 = prop1
| prop1text = prop1text
| references = references
| refractive = refractive
| solubility = solubility
| streak = streak
| strunz = strunz
| symmetry = symmetry
| system = system
| tenacity = tenacity
| twinning = twinning
| unit cell = unit cell
| var1 = var1
| var1text = var1text
| var2 = var2
| var2text = var2text
| var3 = var3
| var3text = var3text
| var4 = var4
| var4text = var4text
| var5 = var5
| var5text = var5text
| var6 = var6
| var6text = var6text

Description[संपादन करीं]

This should describe the parameters used in this template.

Parameter Explanation Example
name IMA mineral name (if there is another common name, put it in parentheses) Baryte (Barite)
boxwidth
boxbgcolor Background color of box headers
boxtextcolor Text color of box headers
image Wikimedia Commons image filename (to go at top) Epidoto.jpeg
imagesize
alt alt text for image, for visually impaired readers; see WP:ALT Agglomeration of dark cylindrical crystals
caption image caption Epidote crystals
category broad group then subgroup then sub-subgroup (if applicable) template does not auto-link Sulfate minerals, Barite group
formula chemical formula giving the elemental composition of a repeating unit of an alloy, a polymer, a crystal structure, a chain, or a network BaSO4
strunz Nickel-Strunz classification of the mineral (10 ed, MinDat) 9.BG.05
dana Dana classification of the mineral 28.03.01.01
symmetry Hermann–Mauguin notation of the mineral's symmetry element, labeled: Space group
unit cell Unit cell dimensions and number (Z) of formula units per unit cell
molweight molar mass of the chemical formula above
color common colors of the mineral
colour same as above, but for British pages
habit common mineral habit
system crystal system (cubic, etc.)
class crystal class
twinning common type of twinning
cleavage type of cleavage
fracture type of fracture (appearance of broken surface) irregular
tenacity tenacity (how the mineral can deform or break) brittle
toughness toughness (quantitative resistance to deformation or breakage)
mohs hardness (scratchability) of mineral on Mohs hardness scale 3-3.5
luster way the mineral reflects light, see luster
lustre same as above, but for British pages
streak see streak
diaphaneity transparency of mineral
gravity specific gravity
density density at STP in g/cm3
polish ability to take a polish
opticalprop
refractive refractive index of mineral
birefringence birefringence of a 30micron thin section
pleochroism see pleochroism
2V 2V angle
dispersion see dispersion
extinction extinction angle, e.g. "parallel", or "inclined" and a quantitative angle. Irrelevant for minerals without an extinction angle (isotropic, opaque, or amorphous minerals).
length fast/slow Sign of elongation: length fast or length slow
fluorescence see fluorescence
absorption see absorption
melt melting point of mineral
Curie Curie temperature of mineral
fusibility fusibility of mineral
diagnostic key way to recognize mineral
solubility solubility of mineral in water at STP
impurities common impurities
alteration alteration products
other
prop1
prop1text
references use the Wikipedia template:ref to cite References supporting the properties to be added at that line using <ref>...</ref> tag notation. Individual items can be tagged separately if needed.
var1
var1text
var2
var2text
var3
var3text
var4
var4text
var5
var5text
var6
var6text

TemplateData[संपादन करीं]

This is the TemplateData documentation for this template used by VisualEditor and other tools.

TemplateData for Infobox mineral

No description.

Template parameters[Edit template data]

ParameterDescriptionTypeStatus
boxwidthboxwidth

no description

Unknownoptional
boxtextcolorboxtextcolor

no description

Unknownoptional
boxbgcolorboxbgcolor

no description

Unknownoptional
namename

no description

Unknownoptional
imageimage

no description

Unknownoptional
imagesizeimagesize

no description

Unknownoptional
altalt

no description

Unknownoptional
captioncaption

no description

Unknownoptional
categorycategory

no description

Unknownoptional
formulaformula

no description

Unknownoptional
strunzstrunz

no description

Unknownoptional
systemsystem

no description

Unknownoptional
danadana

no description

Unknownoptional
classclass

no description

Unknownoptional
symmetrysymmetry

no description

Unknownoptional
unit cellunit cell

no description

Unknownoptional
molweightmolweight

no description

Unknownoptional
colorcolor

no description

Unknownoptional
habithabit

no description

Unknownoptional
twinningtwinning

no description

Unknownoptional
cleavagecleavage

no description

Unknownoptional
fracturefracture

no description

Unknownoptional
tenacitytenacity

no description

Unknownoptional
mohsmohs

no description

Unknownoptional
lusterluster

no description

Unknownoptional
polishpolish

no description

Unknownoptional
opticalpropopticalprop

no description

Unknownoptional
refractiverefractive

no description

Unknownoptional
birefringencebirefringence

no description

Unknownoptional
pleochroismpleochroism

no description

Unknownoptional
2V2V

no description

Unknownoptional
dispersiondispersion

no description

Unknownoptional
extinctionextinction

no description

Unknownoptional
length fast/slowlength fast/slow

no description

Unknownoptional
fluorescencefluorescence

no description

Unknownoptional
absorptionabsorption

no description

Unknownoptional
streakstreak

no description

Unknownoptional
gravitygravity

no description

Unknownoptional
densitydensity

no description

Unknownoptional
meltmelt

no description

Unknownoptional
fusibilityfusibility

no description

Unknownoptional
diagnosticdiagnostic

no description

Unknownoptional
solubilitysolubility

no description

Unknownoptional
diaphaneitydiaphaneity

no description

Unknownoptional
impuritiesimpurities

no description

Unknownoptional
alterationalteration

no description

Unknownoptional
otherother

no description

Unknownoptional
prop1textprop1text

no description

Unknownoptional
referencesreferences

no description

Unknownoptional
colourcolour

no description

Unknownoptional
lustrelustre

no description

Unknownoptional
polish lustrepolish lustre

no description

Unknownoptional
prop1prop1

no description

Unknownoptional
var1var1

no description

Unknownoptional
var1textvar1text

no description

Unknownoptional
var2var2

no description

Unknownoptional
var2textvar2text

no description

Unknownoptional
var3var3

no description

Unknownoptional
var3textvar3text

no description

Unknownoptional
var4var4

no description

Unknownoptional
var4textvar4text

no description

Unknownoptional
var5var5

no description

Unknownoptional
var5textvar5text

no description

Unknownoptional
var6var6

no description

Unknownoptional
var6textvar6text

no description

Unknownoptional
struct imagestruct image

no description

Unknownoptional
struct2 imagestruct2 image

no description

Unknownoptional
struct captionstruct caption

no description

Unknownoptional
struct imagesizestruct imagesize

no description

Unknownoptional
struct altstruct alt

no description

Unknownoptional
struct2 imagesizestruct2 imagesize

no description

Unknownoptional
struct2 captionstruct2 caption

no description

Unknownoptional
struct2 altstruct2 alt

no description

Unknownoptional
JmolJmol

no description

Unknownoptional
SMILESSMILES

no description

Unknownoptional

Tracking category[संपादन करीं]